C22H26O5 — CID 151101290
2-[3-(1,2,3-trimethoxy-9H-fluoren-4-yl)propoxymethyl]oxirane (PubChem CID 151101290) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[3-(1,2,3-trimethoxy-9H-fluoren-4-yl)propoxymethyl]oxirane.
| Compound Name | 2-[3-(1,2,3-trimethoxy-9H-fluoren-4-yl)propoxymethyl]oxirane |
|---|---|
| PubChem CID | 151101290 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-[3-(1,2,3-trimethoxy-9H-fluoren-4-yl)propoxymethyl]oxirane |
| SMILES | COc1c(CCCOCC2CO2)c2c(c(OC)c1OC)Cc1ccccc1-2 |
| InChI | InChI=1S/C22H26O5/c1-23-20-17(9-6-10-26-12-15-13-27-15)19-16-8-5-4-7-14(16)11-18(19)21(24-2)22(20)25-3/h4-5,7-8,15H,6,9-13H2,1-3H3 |
| InChIKey | MOEGPWJFHRXWGB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|