C37H38O6 — CID 161234514
2-[2-[2-methyl-4-[1-[3-methyl-4-[2-(oxiran-2-ylmethoxy)ethoxy]phenyl]-9H-fluoren-2-yl]phenoxy]ethoxymethyl]oxirane (PubChem CID 161234514) has the molecular formula C37H38O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is 2-[2-[2-methyl-4-[1-[3-methyl-4-[2-(oxiran-2-ylmethoxy)ethoxy]phenyl]-9H-fluoren-2-yl]phenoxy]ethoxymethyl]oxirane.
| Compound Name | 2-[2-[2-methyl-4-[1-[3-methyl-4-[2-(oxiran-2-ylmethoxy)ethoxy]phenyl]-9H-fluoren-2-yl]phenoxy]ethoxymethyl]oxirane |
|---|---|
| PubChem CID | 161234514 |
| Molecular Formula | C37H38O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 2-[2-[2-methyl-4-[1-[3-methyl-4-[2-(oxiran-2-ylmethoxy)ethoxy]phenyl]-9H-fluoren-2-yl]phenoxy]ethoxymethyl]oxirane |
| SMILES | Cc1cc(-c2ccc3c(c2-c2ccc(OCCOCC4CO4)c(C)c2)Cc2ccccc2-3)ccc1OCCOCC1CO1 |
| InChI | InChI=1S/C37H38O6/c1-24-17-27(7-11-35(24)40-15-13-38-20-29-22-42-29)32-9-10-33-31-6-4-3-5-26(31)19-34(33)37(32)28-8-12-36(25(2)18-28)41-16-14-39-21-30-23-43-30/h3-12,17-18,29-30H,13-16,19-23H2,1-2H3 |
| InChIKey | UZEREAPVOUFODU-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|