C15H33FO3Si2 — CID 162446225
[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]methyl-[3-(fluoromethoxy)propyl]-dimethylsilane (PubChem CID 162446225) has the molecular formula C15H33FO3Si2 and a molecular weight of 336.60 g/mol. Its IUPAC name is [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]methyl-[3-(fluoromethoxy)propyl]-dimethylsilane.
| Compound Name | [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]methyl-[3-(fluoromethoxy)propyl]-dimethylsilane |
|---|---|
| PubChem CID | 162446225 |
| Molecular Formula | C15H33FO3Si2 |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]methyl-[3-(fluoromethoxy)propyl]-dimethylsilane |
| SMILES | C[Si](C)(CCCOCF)C[Si](C)(C)CCCOCC1CO1 |
| InChI | InChI=1S/C15H33FO3Si2/c1-20(2,9-5-7-17-11-15-12-19-15)14-21(3,4)10-6-8-18-13-16/h15H,5-14H2,1-4H3 |
| InChIKey | BGJWPBCNPSCILQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|