C15H20O2 — CID 174818397
2-[(4-methyl-5-phenylpent-4-enoxy)methyl]oxirane (PubChem CID 174818397) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-[(4-methyl-5-phenylpent-4-enoxy)methyl]oxirane.
| Compound Name | 2-[(4-methyl-5-phenylpent-4-enoxy)methyl]oxirane |
|---|---|
| PubChem CID | 174818397 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 2-[(4-methyl-5-phenylpent-4-enoxy)methyl]oxirane |
| SMILES | CC(=Cc1ccccc1)CCCOCC1CO1 |
| InChI | InChI=1S/C15H20O2/c1-13(10-14-7-3-2-4-8-14)6-5-9-16-11-15-12-17-15/h2-4,7-8,10,15H,5-6,9,11-12H2,1H3 |
| InChIKey | CZTMISINJSHPFT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|