C19H26O4 — CID 6296253
[2-[(E)-1-phenylhept-1-en-2-yl]-1,3-dioxolan-4-yl]methyl acetate (PubChem CID 6296253) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is [2-[(E)-1-phenylhept-1-en-2-yl]-1,3-dioxolan-4-yl]methyl acetate.
| Compound Name | [2-[(E)-1-phenylhept-1-en-2-yl]-1,3-dioxolan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 6296253 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | [2-[(E)-1-phenylhept-1-en-2-yl]-1,3-dioxolan-4-yl]methyl acetate |
| SMILES | CCCCC/C(=C\c1ccccc1)C1OCC(COC(C)=O)O1 |
| InChI | InChI=1S/C19H26O4/c1-3-4-6-11-17(12-16-9-7-5-8-10-16)19-22-14-18(23-19)13-21-15(2)20/h5,7-10,12,18-19H,3-4,6,11,13-14H2,1-2H3/b17-12+ |
| InChIKey | DIVBJTJVOFKRKN-SFQUDFHCSA-N |
| XLogP | 3.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|