C17H24O2 — CID 6374281
4-methyl-2-[(Z)-1-phenylhept-1-en-2-yl]-1,3-dioxolane (PubChem CID 6374281) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-methyl-2-[(Z)-1-phenylhept-1-en-2-yl]-1,3-dioxolane.
| Compound Name | 4-methyl-2-[(Z)-1-phenylhept-1-en-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 6374281 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 4-methyl-2-[(Z)-1-phenylhept-1-en-2-yl]-1,3-dioxolane |
| SMILES | CCCCC/C(=C/c1ccccc1)C1OCC(C)O1 |
| InChI | InChI=1S/C17H24O2/c1-3-4-6-11-16(17-18-13-14(2)19-17)12-15-9-7-5-8-10-15/h5,7-10,12,14,17H,3-4,6,11,13H2,1-2H3/b16-12- |
| InChIKey | ZPFONCVCIDIULW-VBKFSLOCSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|