C27H54O6Si2 — CID 123218706
2-[4-[2-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]butan-2-yloxy-dimethylsilyl]-4-methylhexoxy]ethyl 2-methylprop-2-enoate (PubChem CID 123218706) has the molecular formula C27H54O6Si2 and a molecular weight of 530.90 g/mol. Its IUPAC name is 2-[4-[2-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]butan-2-yloxy-dimethylsilyl]-4-methylhexoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-[2-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]butan-2-yloxy-dimethylsilyl]-4-methylhexoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123218706 |
| Molecular Formula | C27H54O6Si2 |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.35 |
| IUPAC Name | 2-[4-[2-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]butan-2-yloxy-dimethylsilyl]-4-methylhexoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCCC(C)(CC)[Si](C)(C)OC(C)(CC)[Si](C)(C)CCCOCC1CO1 |
| InChI | InChI=1S/C27H54O6Si2/c1-11-26(5,15-13-16-29-18-19-31-25(28)23(3)4)35(9,10)33-27(6,12-2)34(7,8)20-14-17-30-21-24-22-32-24/h24H,3,11-22H2,1-2,4-10H3 |
| InChIKey | KZYLMMUISAYPAO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|