C24H54O7S3 — CID 142987678
[2-(3-hydroxybutoxy)-3-[3-[methyl-bis[(trimethyl-λ4-sulfanyl)oxy]-λ4-sulfanyl]propoxy]propyl] 2-methylprop-2-enoate;propane (PubChem CID 142987678) has the molecular formula C24H54O7S3 and a molecular weight of 550.89 g/mol. Its IUPAC name is [2-(3-hydroxybutoxy)-3-[3-[methyl-bis[(trimethyl-λ4-sulfanyl)oxy]-λ4-sulfanyl]propoxy]propyl] 2-methylprop-2-enoate;propane.
| Compound Name | [2-(3-hydroxybutoxy)-3-[3-[methyl-bis[(trimethyl-λ4-sulfanyl)oxy]-λ4-sulfanyl]propoxy]propyl] 2-methylprop-2-enoate;propane |
|---|---|
| PubChem CID | 142987678 |
| Molecular Formula | C24H54O7S3 |
| Molecular Weight | 550.89 g/mol |
| Exact Mass | 550.30 |
| IUPAC Name | [2-(3-hydroxybutoxy)-3-[3-[methyl-bis[(trimethyl-λ4-sulfanyl)oxy]-λ4-sulfanyl]propoxy]propyl] 2-methylprop-2-enoate;propane |
| SMILES | C=C(C)C(=O)OCC(COCCCS(C)(OS(C)(C)C)OS(C)(C)C)OCCC(C)O.CCC |
| InChI | InChI=1S/C21H46O7S3.C3H8/c1-18(2)21(23)26-17-20(25-14-12-19(3)22)16-24-13-11-15-31(10,27-29(4,5)6)28-30(7,8)9;1-3-2/h19-20,22H,1,11-17H2,2-10H3;3H2,1-2H3 |
| InChIKey | MRRCRIJQKBSQPG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.89 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|