C15H26O6 — CID 172689953
(4-hydroxy-2-propoxybutyl) 2-methylprop-2-enoate;2-methylprop-2-enoic acid (PubChem CID 172689953) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is (4-hydroxy-2-propoxybutyl) 2-methylprop-2-enoate;2-methylprop-2-enoic acid.
| Compound Name | (4-hydroxy-2-propoxybutyl) 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 172689953 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (4-hydroxy-2-propoxybutyl) 2-methylprop-2-enoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCC(CCO)OCCC |
| InChI | InChI=1S/C11H20O4.C4H6O2/c1-4-7-14-10(5-6-12)8-15-11(13)9(2)3;1-3(2)4(5)6/h10,12H,2,4-8H2,1,3H3;1H2,2H3,(H,5,6) |
| InChIKey | BNWKFFDRWPCNHP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|