C14H22O7 — CID 54553675
5-hydroxy-6-[1-hydroxy-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-2-methylidenehexanoic acid (PubChem CID 54553675) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is 5-hydroxy-6-[1-hydroxy-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-2-methylidenehexanoic acid.
| Compound Name | 5-hydroxy-6-[1-hydroxy-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-2-methylidenehexanoic acid |
|---|---|
| PubChem CID | 54553675 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-hydroxy-6-[1-hydroxy-3-(2-methylprop-2-enoyloxy)propan-2-yl]oxy-2-methylidenehexanoic acid |
| SMILES | C=C(C)C(=O)OCC(CO)OCC(O)CCC(=C)C(=O)O |
| InChI | InChI=1S/C14H22O7/c1-9(2)14(19)21-8-12(6-15)20-7-11(16)5-4-10(3)13(17)18/h11-12,15-16H,1,3-8H2,2H3,(H,17,18) |
| InChIKey | ZLRHAKVQHNRGAT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|