C27H44O15 — CID 18689299
[2-hydroxy-3-[1,5,6-trihydroxy-3,4-bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]hexan-2-yl]oxypropyl] 2-methylprop-2-enoate (PubChem CID 18689299) has the molecular formula C27H44O15 and a molecular weight of 608.63 g/mol. Its IUPAC name is [2-hydroxy-3-[1,5,6-trihydroxy-3,4-bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]hexan-2-yl]oxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[1,5,6-trihydroxy-3,4-bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]hexan-2-yl]oxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18689299 |
| Molecular Formula | C27H44O15 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | [2-hydroxy-3-[1,5,6-trihydroxy-3,4-bis[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]hexan-2-yl]oxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(CO)C(OCC(O)COC(=O)C(=C)C)C(OCC(O)COC(=O)C(=C)C)C(O)CO |
| InChI | InChI=1S/C27H44O15/c1-15(2)25(34)40-12-18(30)9-37-22(8-29)24(39-11-20(32)14-42-27(36)17(5)6)23(21(33)7-28)38-10-19(31)13-41-26(35)16(3)4/h18-24,28-33H,1,3,5,7-14H2,2,4,6H3 |
| InChIKey | NHZTUIZNJRIJDM-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 227.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|