C7H11O4P — CID 141058700
3-(2-methylprop-2-enoyloxy)-2-phosphanylpropanoic acid (PubChem CID 141058700) has the molecular formula C7H11O4P and a molecular weight of 190.13 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)-2-phosphanylpropanoic acid.
| Compound Name | 3-(2-methylprop-2-enoyloxy)-2-phosphanylpropanoic acid |
|---|---|
| PubChem CID | 141058700 |
| Molecular Formula | C7H11O4P |
| Molecular Weight | 190.13 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)-2-phosphanylpropanoic acid |
| SMILES | C=C(C)C(=O)OCC(P)C(=O)O |
| InChI | InChI=1S/C7H11O4P/c1-4(2)7(10)11-3-5(12)6(8)9/h5H,1,3,12H2,2H3,(H,8,9) |
| InChIKey | RYUJJEGZKIUDQU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.13 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|