C11H20O4S — CID 89274817
[1-hydroxy-3-(3-methylsulfanylpropoxy)propan-2-yl] 2-methylprop-2-enoate (PubChem CID 89274817) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is [1-hydroxy-3-(3-methylsulfanylpropoxy)propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-hydroxy-3-(3-methylsulfanylpropoxy)propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89274817 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [1-hydroxy-3-(3-methylsulfanylpropoxy)propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CO)COCCCSC |
| InChI | InChI=1S/C11H20O4S/c1-9(2)11(13)15-10(7-12)8-14-5-4-6-16-3/h10,12H,1,4-8H2,2-3H3 |
| InChIKey | OVJDMFZFSHPIRV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|