C13H22O4 — CID 164835881
[1-methoxy-3-(3-methylbut-2-enoxy)propan-2-yl] 2-methylprop-2-enoate (PubChem CID 164835881) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is [1-methoxy-3-(3-methylbut-2-enoxy)propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-methoxy-3-(3-methylbut-2-enoxy)propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 164835881 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [1-methoxy-3-(3-methylbut-2-enoxy)propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COC)COCC=C(C)C |
| InChI | InChI=1S/C13H22O4/c1-10(2)6-7-16-9-12(8-15-5)17-13(14)11(3)4/h6,12H,3,7-9H2,1-2,4-5H3 |
| InChIKey | ZUOILTPGMFKAPH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|