C17H27NO5 — CID 59637752
[1-(4-ethenoxybutoxy)-3-(2-methylprop-2-enoylamino)propan-2-yl] 2-methylprop-2-enoate (PubChem CID 59637752) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is [1-(4-ethenoxybutoxy)-3-(2-methylprop-2-enoylamino)propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-(4-ethenoxybutoxy)-3-(2-methylprop-2-enoylamino)propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59637752 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [1-(4-ethenoxybutoxy)-3-(2-methylprop-2-enoylamino)propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=COCCCCOCC(CNC(=O)C(=C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C17H27NO5/c1-6-21-9-7-8-10-22-12-15(23-17(20)14(4)5)11-18-16(19)13(2)3/h6,15H,1-2,4,7-12H2,3,5H3,(H,18,19) |
| InChIKey | HAXSBNNXYKJIET-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|