C25H45NO3 — CID 135303995
dodecyl 2-methylprop-2-enoate;3-[(Z)-hex-3-enoxy]propanenitrile (PubChem CID 135303995) has the molecular formula C25H45NO3 and a molecular weight of 407.64 g/mol. Its IUPAC name is dodecyl 2-methylprop-2-enoate;3-[(Z)-hex-3-enoxy]propanenitrile.
| Compound Name | dodecyl 2-methylprop-2-enoate;3-[(Z)-hex-3-enoxy]propanenitrile |
|---|---|
| PubChem CID | 135303995 |
| Molecular Formula | C25H45NO3 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.34 |
| IUPAC Name | dodecyl 2-methylprop-2-enoate;3-[(Z)-hex-3-enoxy]propanenitrile |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCC.CC/C=C\CCOCCC#N |
| InChI | InChI=1S/C16H30O2.C9H15NO/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-2-3-4-5-8-11-9-6-7-10/h2,4-14H2,1,3H3;3-4H,2,5-6,8-9H2,1H3/b;4-3- |
| InChIKey | NIHPXISKYGJKLP-QGAMPUOQSA-N |
| XLogP | 7.30 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|