C40H60O18S3 — CID 90228001
2-[3-[2-[2,2-bis[[2-[3-oxo-3-(2-prop-2-enoyloxyethoxy)propyl]sulfanylacetyl]oxymethyl]butoxy]-2-oxoethyl]sulfanylpropanoyloxy]ethyl 4,4-dimethylpentanoate (PubChem CID 90228001) has the molecular formula C40H60O18S3 and a molecular weight of 925.10 g/mol. Its IUPAC name is 2-[3-[2-[2,2-bis[[2-[3-oxo-3-(2-prop-2-enoyloxyethoxy)propyl]sulfanylacetyl]oxymethyl]butoxy]-2-oxoethyl]sulfanylpropanoyloxy]ethyl 4,4-dimethylpentanoate.
| Compound Name | 2-[3-[2-[2,2-bis[[2-[3-oxo-3-(2-prop-2-enoyloxyethoxy)propyl]sulfanylacetyl]oxymethyl]butoxy]-2-oxoethyl]sulfanylpropanoyloxy]ethyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 90228001 |
| Molecular Formula | C40H60O18S3 |
| Molecular Weight | 925.10 g/mol |
| Exact Mass | 924.29 |
| IUPAC Name | 2-[3-[2-[2,2-bis[[2-[3-oxo-3-(2-prop-2-enoyloxyethoxy)propyl]sulfanylacetyl]oxymethyl]butoxy]-2-oxoethyl]sulfanylpropanoyloxy]ethyl 4,4-dimethylpentanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCSCC(=O)OCC(CC)(COC(=O)CSCCC(=O)OCCOC(=O)C=C)COC(=O)CSCCC(=O)OCCOC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C40H60O18S3/c1-7-30(41)50-15-17-53-33(44)11-21-59-24-36(47)56-27-40(9-3,28-57-37(48)25-60-22-12-34(45)54-18-16-51-31(42)8-2)29-58-38(49)26-61-23-13-35(46)55-20-19-52-32(43)10-14-39(4,5)6/h7-8H,1-2,9-29H2,3-6H3 |
| InChIKey | CSXGTBFVXFQCDW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 236.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.10 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|