About 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate
2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate (PubChem CID 155216402) has the molecular formula C13H25O9P
and a molecular weight of 356.31 g/mol. Its IUPAC name is 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate |
| PubChem CID | 155216402 |
| Molecular Formula | C13H25O9P |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate |
| SMILES | C=CC(O)OCCOP(=O)(OCCO)OCCOC(O)C(=C)C |
| InChI | InChI=1S/C13H25O9P/c1-4-12(15)18-7-9-21-23(17,20-6-5-14)22-10-8-19-13(16)11(2)3/h4,12-16H,1-2,5-10H2,3H3 |
| InChIKey | XVBRKVLMBAJGPK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate?
The IUPAC name of 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate (CID 155216402) is 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate.
What is the SMILES notation for 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate?
The canonical SMILES for 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate is C=CC(O)OCCOP(=O)(OCCO)OCCOC(O)C(=C)C.
What is the InChIKey of 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate?
The InChIKey is XVBRKVLMBAJGPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25O9P/c1-4-12(15)18-7-9-21-23(17,20-6-5-14)22-10-8-19-13(16)11(2)3/h4,12-16H,1-2,5-10H2,3H3.
What are the key properties of 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate?
2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate has a molecular weight of 356.31 g/mol, XLogP of 0.57, 15 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-(1-hydroxy-2-methylprop-2-enoxy)ethyl 2-(1-hydroxyprop-2-enoxy)ethyl phosphate is sourced from PubChem (CID 155216402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).