C18H29NO12P2 — CID 101420429
N-[hydroxy-bis[2-(2-methylprop-2-enoyloxy)ethoxy]-λ5-phosphanylidene]-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphonamidic acid (PubChem CID 101420429) has the molecular formula C18H29NO12P2 and a molecular weight of 513.37 g/mol. Its IUPAC name is N-[hydroxy-bis[2-(2-methylprop-2-enoyloxy)ethoxy]-λ5-phosphanylidene]-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphonamidic acid.
| Compound Name | N-[hydroxy-bis[2-(2-methylprop-2-enoyloxy)ethoxy]-λ5-phosphanylidene]-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphonamidic acid |
|---|---|
| PubChem CID | 101420429 |
| Molecular Formula | C18H29NO12P2 |
| Molecular Weight | 513.37 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | N-[hydroxy-bis[2-(2-methylprop-2-enoyloxy)ethoxy]-λ5-phosphanylidene]-[2-(2-methylprop-2-enoyloxy)ethoxy]phosphonamidic acid |
| SMILES | C=C(C)C(=O)OCCOP(=O)(O)N=P(O)(OCCOC(=O)C(=C)C)OCCOC(=O)C(=C)C |
| InChI | InChI=1S/C18H29NO12P2/c1-13(2)16(20)26-7-10-29-32(23,24)19-33(25,30-11-8-27-17(21)14(3)4)31-12-9-28-18(22)15(5)6/h25H,1,3,5,7-12H2,2,4,6H3,(H,23,24) |
| InChIKey | PZYKMBRARAQDRJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 176.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|