C14H27FNO7P — CID 22178352
1,1-diethoxyethyl-[1-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopropyl]phosphinic acid (PubChem CID 22178352) has the molecular formula C14H27FNO7P and a molecular weight of 371.34 g/mol. Its IUPAC name is 1,1-diethoxyethyl-[1-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopropyl]phosphinic acid.
| Compound Name | 1,1-diethoxyethyl-[1-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopropyl]phosphinic acid |
|---|---|
| PubChem CID | 22178352 |
| Molecular Formula | C14H27FNO7P |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1,1-diethoxyethyl-[1-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxopropyl]phosphinic acid |
| SMILES | CCOC(C)(OCC)P(=O)(O)C(F)C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27FNO7P/c1-7-21-14(6,22-8-2)24(19,20)11(15)10(17)9-16-12(18)23-13(3,4)5/h11H,7-9H2,1-6H3,(H,16,18)(H,19,20) |
| InChIKey | KPTLWJYMJWQWPD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|