C28H36NO8P — CID 69453945
dibenzyl 2-[1-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phosphorosobutyl]pentanedioate (PubChem CID 69453945) has the molecular formula C28H36NO8P and a molecular weight of 545.57 g/mol. Its IUPAC name is dibenzyl 2-[1-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phosphorosobutyl]pentanedioate.
| Compound Name | dibenzyl 2-[1-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phosphorosobutyl]pentanedioate |
|---|---|
| PubChem CID | 69453945 |
| Molecular Formula | C28H36NO8P |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | dibenzyl 2-[1-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phosphorosobutyl]pentanedioate |
| SMILES | CC(C)(C)OC(=O)NCCCC(O)(P=O)C(CCC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H36NO8P/c1-27(2,3)37-26(32)29-18-10-17-28(33,38-34)23(25(31)36-20-22-13-8-5-9-14-22)15-16-24(30)35-19-21-11-6-4-7-12-21/h4-9,11-14,23,33H,10,15-20H2,1-3H3,(H,29,32) |
| InChIKey | JPLQUBYXEPZSPU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|