C28H36NO8P — CID 87839709
4-(1,2-diphenylethoxycarbonyl)-5-hydroxy-8-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phosphorosooctanoic acid (PubChem CID 87839709) has the molecular formula C28H36NO8P and a molecular weight of 545.57 g/mol. Its IUPAC name is 4-(1,2-diphenylethoxycarbonyl)-5-hydroxy-8-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phosphorosooctanoic acid.
| Compound Name | 4-(1,2-diphenylethoxycarbonyl)-5-hydroxy-8-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phosphorosooctanoic acid |
|---|---|
| PubChem CID | 87839709 |
| Molecular Formula | C28H36NO8P |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 4-(1,2-diphenylethoxycarbonyl)-5-hydroxy-8-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phosphorosooctanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCC(O)(P=O)C(CCC(=O)O)C(=O)OC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36NO8P/c1-27(2,3)37-26(33)29-18-10-17-28(34,38-35)22(15-16-24(30)31)25(32)36-23(21-13-8-5-9-14-21)19-20-11-6-4-7-12-20/h4-9,11-14,22-23,34H,10,15-19H2,1-3H3,(H,29,33)(H,30,31) |
| InChIKey | LNDIMCYQWYFXCK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|