C69H74N10O16 — CID 177483019
(4-nitrophenyl) N,N-bis[2-[[4-[bis[2-[(2-phenylacetyl)amino]ethyl]carbamoyloxy]phenyl]methoxycarbonylamino]ethyl]carbamate (PubChem CID 177483019) has the molecular formula C69H74N10O16 and a molecular weight of 1299.40 g/mol. Its IUPAC name is (4-nitrophenyl) N,N-bis[2-[[4-[bis[2-[(2-phenylacetyl)amino]ethyl]carbamoyloxy]phenyl]methoxycarbonylamino]ethyl]carbamate.
| Compound Name | (4-nitrophenyl) N,N-bis[2-[[4-[bis[2-[(2-phenylacetyl)amino]ethyl]carbamoyloxy]phenyl]methoxycarbonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 177483019 |
| Molecular Formula | C69H74N10O16 |
| Molecular Weight | 1299.40 g/mol |
| Exact Mass | 1298.53 |
| IUPAC Name | (4-nitrophenyl) N,N-bis[2-[[4-[bis[2-[(2-phenylacetyl)amino]ethyl]carbamoyloxy]phenyl]methoxycarbonylamino]ethyl]carbamate |
| SMILES | O=C(Cc1ccccc1)NCCN(CCNC(=O)Cc1ccccc1)C(=O)Oc1ccc(COC(=O)NCCN(CCNC(=O)OCc2ccc(OC(=O)N(CCNC(=O)Cc3ccccc3)CCNC(=O)Cc3ccccc3)cc2)C(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C69H74N10O16/c80-61(45-51-13-5-1-6-14-51)70-33-39-76(40-34-71-62(81)46-52-15-7-2-8-16-52)67(86)93-58-27-21-55(22-28-58)49-91-65(84)74-37-43-78(69(88)95-60-31-25-57(26-32-60)79(89)90)44-38-75-66(85)92-50-56-23-29-59(30-24-56)94-68(87)77(41-35-72-63(82)47-53-17-9-3-10-18-53)42-36-73-64(83)48-54-19-11-4-12-20-54/h1-32H,33-50H2,(H,70,80)(H,71,81)(H,72,82)(H,73,83)(H,74,84)(H,75,85) |
| InChIKey | MAIPIDWURZFVAO-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 324.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 95 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1299.40 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|