C23H22N6O9S2 — CID 86738683
(4-nitrophenyl)methyl (6R)-3-(acetyloxymethylidene)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 86738683) has the molecular formula C23H22N6O9S2 and a molecular weight of 590.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-3-(acetyloxymethylidene)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-3-(acetyloxymethylidene)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 86738683 |
| Molecular Formula | C23H22N6O9S2 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.09 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-3-(acetyloxymethylidene)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)C(=COC(C)=O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C23H22N6O9S2/c1-11(30)37-8-13-9-39-21-17(26-19(31)16(27-36-2)15-10-40-23(24)25-15)20(32)28(21)18(13)22(33)38-7-12-3-5-14(6-4-12)29(34)35/h3-6,8,10,17-18,21H,7,9H2,1-2H3,(H2,24,25)(H,26,31)/t17?,18?,21-/m1/s1 |
| InChIKey | JYENBGFCDOXSQF-WIXQSORDSA-N |
| XLogP | 0.94 |
| TPSA | 205.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|