C24H22N6O10S2 — CID 173359374
(6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173359374) has the molecular formula C24H22N6O10S2 and a molecular weight of 618.61 g/mol. Its IUPAC name is (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173359374 |
| Molecular Formula | C24H22N6O10S2 |
| Molecular Weight | 618.61 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | (6R)-3-ethenyl-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-[2-[(4-nitrophenyl)methoxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | C=CC1(C(=O)O)CS[C@@H]2C(NC(=O)C(=NOCC(=O)OCc3ccc([N+](=O)[O-])cc3)c3csc(NC=O)n3)C(=O)N2C1 |
| InChI | InChI=1S/C24H22N6O10S2/c1-2-24(22(35)36)10-29-20(34)18(21(29)42-11-24)27-19(33)17(15-9-41-23(26-15)25-12-31)28-40-8-16(32)39-7-13-3-5-14(6-4-13)30(37)38/h2-6,9,12,18,21H,1,7-8,10-11H2,(H,27,33)(H,35,36)(H,25,26,31)/t18?,21-,24?/m1/s1 |
| InChIKey | VRZAWMFDCXUOLJ-RUPGZQMFSA-N |
| XLogP | 0.74 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.61 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|