C20H17N5O9S2 — CID 88737418
(4-nitrophenyl)methyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 88737418) has the molecular formula C20H17N5O9S2 and a molecular weight of 535.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 88737418 |
| Molecular Formula | C20H17N5O9S2 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-oxoacetyl]amino]-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | O=CNc1nc(C(=O)C(=O)NC2C(=O)N3CC(O)(C(=O)OCc4ccc([N+](=O)[O-])cc4)CS[C@H]23)cs1 |
| InChI | InChI=1S/C20H17N5O9S2/c26-9-21-19-22-12(6-35-19)14(27)15(28)23-13-16(29)24-7-20(31,8-36-17(13)24)18(30)34-5-10-1-3-11(4-2-10)25(32)33/h1-4,6,9,13,17,31H,5,7-8H2,(H,23,28)(H,21,22,26)/t13?,17-,20?/m1/s1 |
| InChIKey | NFDSGDOBWNKBSW-DJMMNXNOSA-N |
| XLogP | -0.32 |
| TPSA | 198.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|