C22H16ClF3N6O8S2 — CID 131712486
(4-nitrophenyl)methyl (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131712486) has the molecular formula C22H16ClF3N6O8S2 and a molecular weight of 648.99 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131712486 |
| Molecular Formula | C22H16ClF3N6O8S2 |
| Molecular Weight | 648.99 g/mol |
| Exact Mass | 648.01 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethoxyimino)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=CNc1nc(C(=NOCC(F)(F)F)C(=O)NC2C(=O)N3C(C(=O)OCc4ccc([N+](=O)[O-])cc4)=C(Cl)CS[C@H]23)cs1 |
| InChI | InChI=1S/C22H16ClF3N6O8S2/c23-12-6-41-19-15(18(35)31(19)16(12)20(36)39-5-10-1-3-11(4-2-10)32(37)38)29-17(34)14(30-40-8-22(24,25)26)13-7-42-21(28-13)27-9-33/h1-4,7,9,15,19H,5-6,8H2,(H,29,34)(H,27,28,33)/t15?,19-/m1/s1 |
| InChIKey | JTAINDUMZOYKLK-XCWJXAQQSA-N |
| XLogP | 2.50 |
| TPSA | 182.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.99 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|