C23H20ClN6O8S2- — CID 131715922
(6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131715922) has the molecular formula C23H20ClN6O8S2- and a molecular weight of 608.03 g/mol. Its IUPAC name is (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131715922 |
| Molecular Formula | C23H20ClN6O8S2- |
| Molecular Weight | 608.03 g/mol |
| Exact Mass | 607.05 |
| IUPAC Name | (6R)-3-chloro-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-4-[(4-nitrophenyl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(Cl)C(Cc3ccc([N+](=O)[O-])cc3)S[C@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C23H21ClN6O8S2/c1-2-7-38-28-16(13-9-39-23(26-13)25-10-31)19(32)27-17-20(33)29-18(22(34)35)15(24)14(40-21(17)29)8-11-3-5-12(6-4-11)30(36)37/h3-6,9-10,14,17,21H,2,7-8H2,1H3,(H,27,32)(H,34,35)(H,25,26,31)/p-1/t14?,17?,21-/m1/s1 |
| InChIKey | QOMPKNQCRUNFET-KDDGLUCOSA-M |
| XLogP | 0.96 |
| TPSA | 196.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.03 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|