C23H23N3O8S — CID 70615075
(4-nitrophenyl)methyl (6R)-7-(N-acetyl-4-methoxyanilino)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 70615075) has the molecular formula C23H23N3O8S and a molecular weight of 501.52 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-(N-acetyl-4-methoxyanilino)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-(N-acetyl-4-methoxyanilino)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 70615075 |
| Molecular Formula | C23H23N3O8S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-(N-acetyl-4-methoxyanilino)-3-hydroxy-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | COc1ccc(N(C(C)=O)C2C(=O)N3CC(O)(C(=O)OCc4ccc([N+](=O)[O-])cc4)CS[C@H]23)cc1 |
| InChI | InChI=1S/C23H23N3O8S/c1-14(27)25(16-7-9-18(33-2)10-8-16)19-20(28)24-12-23(30,13-35-21(19)24)22(29)34-11-15-3-5-17(6-4-15)26(31)32/h3-10,19,21,30H,11-13H2,1-2H3/t19?,21-,23?/m1/s1 |
| InChIKey | TWPVRGSIRGXBCZ-YUVVGHDESA-N |
| XLogP | 1.71 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|