C33H29N3O10S — CID 88818264
(4-nitrophenyl)methyl (6R)-7-(N-acetylanilino)-3-(acetyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate;3-phenyloxiran-2-one (PubChem CID 88818264) has the molecular formula C33H29N3O10S and a molecular weight of 659.67 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-(N-acetylanilino)-3-(acetyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate;3-phenyloxiran-2-one.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-(N-acetylanilino)-3-(acetyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate;3-phenyloxiran-2-one |
|---|---|
| PubChem CID | 88818264 |
| Molecular Formula | C33H29N3O10S |
| Molecular Weight | 659.67 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-(N-acetylanilino)-3-(acetyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate;3-phenyloxiran-2-one |
| SMILES | CC(=O)OCC1=CN2C(=O)C(N(C(C)=O)c3ccccc3)[C@H]2SC1C(=O)OCc1ccc([N+](=O)[O-])cc1.O=C1OC1c1ccccc1 |
| InChI | InChI=1S/C25H23N3O8S.C8H6O2/c1-15(29)27(19-6-4-3-5-7-19)21-23(31)26-12-18(14-35-16(2)30)22(37-24(21)26)25(32)36-13-17-8-10-20(11-9-17)28(33)34;9-8-7(10-8)6-4-2-1-3-5-6/h3-12,21-22,24H,13-14H2,1-2H3;1-5,7H/t21?,22?,24-;/m1./s1 |
| InChIKey | UYDYJBXMGQIRCL-LQRHRDKQSA-N |
| XLogP | 4.07 |
| TPSA | 165.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|