C28H29ClN4O8S — CID 70635510
tert-butyl (6R)-3-(chloromethyl)-7-[[2-[(4-nitrophenyl)methoxycarbonylamino]-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate (PubChem CID 70635510) has the molecular formula C28H29ClN4O8S and a molecular weight of 617.08 g/mol. Its IUPAC name is tert-butyl (6R)-3-(chloromethyl)-7-[[2-[(4-nitrophenyl)methoxycarbonylamino]-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate.
| Compound Name | tert-butyl (6R)-3-(chloromethyl)-7-[[2-[(4-nitrophenyl)methoxycarbonylamino]-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
|---|---|
| PubChem CID | 70635510 |
| Molecular Formula | C28H29ClN4O8S |
| Molecular Weight | 617.08 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | tert-butyl (6R)-3-(chloromethyl)-7-[[2-[(4-nitrophenyl)methoxycarbonylamino]-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1S[C@@H]2C(NC(=O)C(NC(=O)OCc3ccc([N+](=O)[O-])cc3)c3ccccc3)C(=O)N2C=C1CCl |
| InChI | InChI=1S/C28H29ClN4O8S/c1-28(2,3)41-26(36)22-18(13-29)14-32-24(35)21(25(32)42-22)30-23(34)20(17-7-5-4-6-8-17)31-27(37)40-15-16-9-11-19(12-10-16)33(38)39/h4-12,14,20-22,25H,13,15H2,1-3H3,(H,30,34)(H,31,37)/t20?,21?,22?,25-/m1/s1 |
| InChIKey | MCDQBRKKCLGXCD-NXGWVLSSSA-N |
| XLogP | 3.80 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.08 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|