C23H19N3O8S — CID 70633286
2-[[(6R)-3-methyl-4-[(4-nitrophenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid (PubChem CID 70633286) has the molecular formula C23H19N3O8S and a molecular weight of 497.49 g/mol. Its IUPAC name is 2-[[(6R)-3-methyl-4-[(4-nitrophenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[(6R)-3-methyl-4-[(4-nitrophenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 70633286 |
| Molecular Formula | C23H19N3O8S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 2-[[(6R)-3-methyl-4-[(4-nitrophenyl)methoxycarbonyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]carbamoyl]benzoic acid |
| SMILES | CC1=CN2C(=O)C(NC(=O)c3ccccc3C(=O)O)[C@H]2SC1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19N3O8S/c1-12-10-25-20(28)17(24-19(27)15-4-2-3-5-16(15)22(29)30)21(25)35-18(12)23(31)34-11-13-6-8-14(9-7-13)26(32)33/h2-10,17-18,21H,11H2,1H3,(H,24,27)(H,29,30)/t17?,18?,21-/m1/s1 |
| InChIKey | ZXAWTFYWAHZSNH-WIXQSORDSA-N |
| XLogP | 2.32 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|