C25H23N3O10S2 — CID 173431786
(4-nitrophenyl)methyl (6R)-3-(acetyloxymethyl)-7-[acetyl(thiophen-2-yl)amino]-4-(formyloxymethylidene)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173431786) has the molecular formula C25H23N3O10S2 and a molecular weight of 589.60 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-3-(acetyloxymethyl)-7-[acetyl(thiophen-2-yl)amino]-4-(formyloxymethylidene)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-3-(acetyloxymethyl)-7-[acetyl(thiophen-2-yl)amino]-4-(formyloxymethylidene)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173431786 |
| Molecular Formula | C25H23N3O10S2 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.08 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-3-(acetyloxymethyl)-7-[acetyl(thiophen-2-yl)amino]-4-(formyloxymethylidene)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CC(=O)OCC1(C(=O)OCc2ccc([N+](=O)[O-])cc2)CN2C(=O)C(N(C(C)=O)c3cccs3)[C@H]2SC1=COC=O |
| InChI | InChI=1S/C25H23N3O10S2/c1-15(30)27(20-4-3-9-39-20)21-22(32)26-12-25(13-38-16(2)31,19(11-36-14-29)40-23(21)26)24(33)37-10-17-5-7-18(8-6-17)28(34)35/h3-9,11,14,21,23H,10,12-13H2,1-2H3/t21?,23-,25?/m1/s1 |
| InChIKey | CROZPWGMBJZBNR-XRODLIKFSA-N |
| XLogP | 2.60 |
| TPSA | 162.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|