C25H26N4O8S2 — CID 70499161
(4-nitrophenyl)methyl (6R,7R)-7-[acetyl(thiophen-2-yl)amino]-3-[(2-hydroxyoxan-2-yl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70499161) has the molecular formula C25H26N4O8S2 and a molecular weight of 574.64 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R,7R)-7-[acetyl(thiophen-2-yl)amino]-3-[(2-hydroxyoxan-2-yl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R,7R)-7-[acetyl(thiophen-2-yl)amino]-3-[(2-hydroxyoxan-2-yl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70499161 |
| Molecular Formula | C25H26N4O8S2 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.12 |
| IUPAC Name | (4-nitrophenyl)methyl (6R,7R)-7-[acetyl(thiophen-2-yl)amino]-3-[(2-hydroxyoxan-2-yl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)N(c1cccs1)[C@@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(NC3(O)CCCCO3)CS[C@H]12 |
| InChI | InChI=1S/C25H26N4O8S2/c1-15(30)27(19-5-4-12-38-19)21-22(31)28-20(24(32)36-13-16-6-8-17(9-7-16)29(34)35)18(14-39-23(21)28)26-25(33)10-2-3-11-37-25/h4-9,12,21,23,26,33H,2-3,10-11,13-14H2,1H3/t21-,23-,25?/m1/s1 |
| InChIKey | SZSAAQACBHQBCD-HDOOXHBUSA-N |
| XLogP | 2.68 |
| TPSA | 151.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|