C20H24N8O7S3 — CID 173441355
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(4-butyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173441355) has the molecular formula C20H24N8O7S3 and a molecular weight of 584.66 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(4-butyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(4-butyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173441355 |
| Molecular Formula | C20H24N8O7S3 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-[(4-butyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CCCCn1c(SCC2(C(=O)O)CS[C@@H]3C(NC(=O)C(=NO)c4csc(N)n4)C(=O)N3C2)n[nH]c(=O)c1=O |
| InChI | InChI=1S/C20H24N8O7S3/c1-2-3-4-27-15(32)13(30)24-25-19(27)38-8-20(17(33)34)6-28-14(31)11(16(28)37-7-20)23-12(29)10(26-35)9-5-36-18(21)22-9/h5,11,16,35H,2-4,6-8H2,1H3,(H2,21,22)(H,23,29)(H,24,30)(H,33,34)/t11?,16-,20?/m1/s1 |
| InChIKey | SXFZJDNVAZKYTH-DKDSUDDTSA-N |
| XLogP | -0.79 |
| TPSA | 225.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|