C28H31N5O9S — CID 88719700
2,2-dimethylpropanoyl (6S)-7-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methyl-4,8-dioxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88719700) has the molecular formula C28H31N5O9S and a molecular weight of 613.65 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl (6S)-7-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methyl-4,8-dioxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2-dimethylpropanoyl (6S)-7-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methyl-4,8-dioxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88719700 |
| Molecular Formula | C28H31N5O9S |
| Molecular Weight | 613.65 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 2,2-dimethylpropanoyl (6S)-7-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetyl]amino]-3-methyl-4,8-dioxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCN1CCN(C(=O)NC(C(=O)NC2C(=O)N3C(C(=O)OC(=O)C(C)(C)C)=C(C)C(=O)S[C@@H]23)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C28H31N5O9S/c1-6-31-12-13-32(22(37)21(31)36)27(41)30-16(15-10-8-7-9-11-15)19(34)29-17-20(35)33-18(14(2)25(39)43-23(17)33)24(38)42-26(40)28(3,4)5/h7-11,16-17,23H,6,12-13H2,1-5H3,(H,29,34)(H,30,41)/t16?,17?,23-/m0/s1 |
| InChIKey | HNDUFXYNOIYVJX-OCJFHSIUSA-N |
| XLogP | 0.44 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.65 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|