C15H18N3NaO8S — CID 70390899
sodium 3-methoxy-2-oxo-3-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]azetidine-1-sulfonate (PubChem CID 70390899) has the molecular formula C15H18N3NaO8S and a molecular weight of 423.38 g/mol. Its IUPAC name is sodium 3-methoxy-2-oxo-3-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]azetidine-1-sulfonate.
| Compound Name | sodium 3-methoxy-2-oxo-3-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]azetidine-1-sulfonate |
|---|---|
| PubChem CID | 70390899 |
| Molecular Formula | C15H18N3NaO8S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | sodium 3-methoxy-2-oxo-3-[[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]amino]azetidine-1-sulfonate |
| SMILES | COC1(NC(=O)[C@@H](C)NC(=O)OCc2ccccc2)CN(S(=O)(=O)[O-])C1=O.[Na+] |
| InChI | InChI=1S/C15H19N3O8S.Na/c1-10(16-14(21)26-8-11-6-4-3-5-7-11)12(19)17-15(25-2)9-18(13(15)20)27(22,23)24;/h3-7,10H,8-9H2,1-2H3,(H,16,21)(H,17,19)(H,22,23,24);/q;+1/p-1/t10-,15?;/m1./s1 |
| InChIKey | NDIOXJPJZOSZFO-KOPACZMBSA-M |
| XLogP | -3.93 |
| TPSA | 154.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | -3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|