C23H29N5O8S — CID 137348327
(2R,4R,5R)-2-[(1R)-1-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-2-oxoethyl]-5-methyl-1,3-thiazinane-4-carboxylic acid (PubChem CID 137348327) has the molecular formula C23H29N5O8S and a molecular weight of 535.58 g/mol. Its IUPAC name is (2R,4R,5R)-2-[(1R)-1-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-2-oxoethyl]-5-methyl-1,3-thiazinane-4-carboxylic acid.
| Compound Name | (2R,4R,5R)-2-[(1R)-1-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-2-oxoethyl]-5-methyl-1,3-thiazinane-4-carboxylic acid |
|---|---|
| PubChem CID | 137348327 |
| Molecular Formula | C23H29N5O8S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | (2R,4R,5R)-2-[(1R)-1-[[(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetyl]amino]-2-oxoethyl]-5-methyl-1,3-thiazinane-4-carboxylic acid |
| SMILES | CCN1CCN(C(=O)N[C@@H](C(=O)N[C@H](C=O)[C@@H]2N[C@@H](C(=O)O)[C@@H](C)CS2)c2ccc(O)cc2)C(=O)C1=O |
| InChI | InChI=1S/C23H29N5O8S/c1-3-27-8-9-28(21(33)20(27)32)23(36)26-17(13-4-6-14(30)7-5-13)18(31)24-15(10-29)19-25-16(22(34)35)12(2)11-37-19/h4-7,10,12,15-17,19,25,30H,3,8-9,11H2,1-2H3,(H,24,31)(H,26,36)(H,34,35)/t12-,15+,16+,17+,19+/m0/s1 |
| InChIKey | XXVXTCZUKVAJAU-BMBOTXNISA-N |
| XLogP | -0.73 |
| TPSA | 185.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|