About CID 131883402
CID 131883402 (PubChem CID 131883402) has the molecular formula C13H15KNO5
and a molecular weight of 304.36 g/mol.
Molecular Properties
| Compound Name | CID 131883402 |
| PubChem CID | 131883402 |
| Molecular Formula | C13H15KNO5 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | — |
| SMILES | COC(=O)/C=C(/C)N[C@@H](C(=O)O)c1ccc(O)cc1.[K] |
| InChI | InChI=1S/C13H15NO5.K/c1-8(7-11(16)19-2)14-12(13(17)18)9-3-5-10(15)6-4-9;/h3-7,12,14-15H,1-2H3,(H,17,18);/b8-7-;/t12-;/m1./s1 |
| InChIKey | RUDNTXNLNGLWFQ-HAPRMPPKSA-N |
| XLogP | 0.80 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 131883402 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131883402?
The IUPAC name of CID 131883402 (CID 131883402) is not available.
What is the SMILES notation for CID 131883402?
The canonical SMILES for CID 131883402 is COC(=O)/C=C(/C)N[C@@H](C(=O)O)c1ccc(O)cc1.[K].
What is the InChIKey of CID 131883402?
The InChIKey is RUDNTXNLNGLWFQ-HAPRMPPKSA-N. The full InChI is InChI=1S/C13H15NO5.K/c1-8(7-11(16)19-2)14-12(13(17)18)9-3-5-10(15)6-4-9;/h3-7,12,14-15H,1-2H3,(H,17,18);/b8-7-;/t12-;/m1./s1.
What are the key properties of CID 131883402?
CID 131883402 has a molecular weight of 304.36 g/mol, XLogP of 0.80, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131883402 is sourced from PubChem (CID 131883402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).