C13H15KNO5 — CID 131883402
CID 131883402 (PubChem CID 131883402) has the molecular formula C13H15KNO5 and a molecular weight of 304.36 g/mol.
| Compound Name | CID 131883402 |
|---|---|
| PubChem CID | 131883402 |
| Molecular Formula | C13H15KNO5 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | — |
| SMILES | COC(=O)/C=C(/C)N[C@@H](C(=O)O)c1ccc(O)cc1.[K] |
| InChI | InChI=1S/C13H15NO5.K/c1-8(7-11(16)19-2)14-12(13(17)18)9-3-5-10(15)6-4-9;/h3-7,12,14-15H,1-2H3,(H,17,18);/b8-7-;/t12-;/m1./s1 |
| InChIKey | RUDNTXNLNGLWFQ-HAPRMPPKSA-N |
| XLogP | 0.80 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|