2-formamido-2-(4-hydroxyphenyl)acetic acid

C9H9NO4 — CID 10171318

IUPAC2-formamido-2-(4-hydroxyphenyl)acetic acid
SMILESO=CNC(C(=O)O)c1ccc(O)cc1
InChIInChI=1S/C9H9NO4/c11-5-10-8(9(13)14)6-1-3-7(12)4-2-6/h1-5,8,12H,(H,10,11)(H,13,14)
InChIKeySAHFOUZXHOFVOY-UHFFFAOYSA-N
MW195.17 g/mol
LogP0.26
Rot. Bonds4

About 2-formamido-2-(4-hydroxyphenyl)acetic acid

2-formamido-2-(4-hydroxyphenyl)acetic acid (PubChem CID 10171318) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is 2-formamido-2-(4-hydroxyphenyl)acetic acid.

Molecular Properties

Compound Name2-formamido-2-(4-hydroxyphenyl)acetic acid
PubChem CID10171318
Molecular FormulaC9H9NO4
Molecular Weight195.17 g/mol
Exact Mass195.05
IUPAC Name2-formamido-2-(4-hydroxyphenyl)acetic acid
SMILESO=CNC(C(=O)O)c1ccc(O)cc1
InChIInChI=1S/C9H9NO4/c11-5-10-8(9(13)14)6-1-3-7(12)4-2-6/h1-5,8,12H,(H,10,11)(H,13,14)
InChIKeySAHFOUZXHOFVOY-UHFFFAOYSA-N
XLogP0.26
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.17
LogP ≤ 50.26
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-formamido-2-(4-hydroxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-(4-hydroxyphenyl)-2-iodoacetic acid
CID 155461000
2-(4-bromoanilino)-2-(4-hydroxyphenyl)acetic acid
CID 54890913
2-(4-hydroxyphenyl)-2-(4-methylanilino)acetic acid
CID 54890022
2-(2-chloro-3-hydroxyphenyl)-2-formamidoacetic acid
CID 127019839
2-formamido-2-thiophen-2-ylacetic acid
CID 21492681
CID 131883402
CID 131883402
(2R)-2-formamido-N,2-diphenylacetamide
CID 167282535
CID 70480259
CID 70480259
2-(2-azidoethylamino)-2-(4-hydroxyphenyl)acetic acid
CID 66189404
2-formamido-2-naphthalen-1-ylacetic acid
CID 63689501
2-(4-hydroxyphenyl)-2-(2-methoxyanilino)acetic acid
CID 60993438
(2R)-2-[(2-fluorophenyl)methylamino]-2-(4-hydroxyphenyl)acetic acid
CID 166226941

Frequently Asked Questions

What is the IUPAC name of 2-formamido-2-(4-hydroxyphenyl)acetic acid?
The IUPAC name of 2-formamido-2-(4-hydroxyphenyl)acetic acid (CID 10171318) is 2-formamido-2-(4-hydroxyphenyl)acetic acid.
What is the SMILES notation for 2-formamido-2-(4-hydroxyphenyl)acetic acid?
The canonical SMILES for 2-formamido-2-(4-hydroxyphenyl)acetic acid is O=CNC(C(=O)O)c1ccc(O)cc1.
What is the InChIKey of 2-formamido-2-(4-hydroxyphenyl)acetic acid?
The InChIKey is SAHFOUZXHOFVOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4/c11-5-10-8(9(13)14)6-1-3-7(12)4-2-6/h1-5,8,12H,(H,10,11)(H,13,14).
What are the key properties of 2-formamido-2-(4-hydroxyphenyl)acetic acid?
2-formamido-2-(4-hydroxyphenyl)acetic acid has a molecular weight of 195.17 g/mol, XLogP of 0.26, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formamido-2-(4-hydroxyphenyl)acetic acid is sourced from PubChem (CID 10171318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).