C9H8ClNO4 — CID 127019839
2-(2-chloro-3-hydroxyphenyl)-2-formamidoacetic acid (PubChem CID 127019839) has the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. Its IUPAC name is 2-(2-chloro-3-hydroxyphenyl)-2-formamidoacetic acid.
| Compound Name | 2-(2-chloro-3-hydroxyphenyl)-2-formamidoacetic acid |
|---|---|
| PubChem CID | 127019839 |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2-(2-chloro-3-hydroxyphenyl)-2-formamidoacetic acid |
| SMILES | O=CNC(C(=O)O)c1cccc(O)c1Cl |
| InChI | InChI=1S/C9H8ClNO4/c10-7-5(2-1-3-6(7)13)8(9(14)15)11-4-12/h1-4,8,13H,(H,11,12)(H,14,15) |
| InChIKey | QHHXYTOTTITRFJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|