C15H14ClFN2O2 — CID 81146886
2-(3-chloro-4-fluorophenyl)-2-(4-methoxyanilino)acetamide (PubChem CID 81146886) has the molecular formula C15H14ClFN2O2 and a molecular weight of 308.74 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-2-(4-methoxyanilino)acetamide.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-2-(4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 81146886 |
| Molecular Formula | C15H14ClFN2O2 |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-2-(4-methoxyanilino)acetamide |
| SMILES | COc1ccc(NC(C(N)=O)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14ClFN2O2/c1-21-11-5-3-10(4-6-11)19-14(15(18)20)9-2-7-13(17)12(16)8-9/h2-8,14,19H,1H3,(H2,18,20) |
| InChIKey | IKYWGPCVDXNDTO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|