C14H14ClN3O2 — CID 114937350
2-(4-chloroanilino)-2-(6-methoxy-3-pyridinyl)acetamide (PubChem CID 114937350) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 2-(4-chloroanilino)-2-(6-methoxy-3-pyridinyl)acetamide.
| Compound Name | 2-(4-chloroanilino)-2-(6-methoxy-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 114937350 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-(4-chloroanilino)-2-(6-methoxy-3-pyridinyl)acetamide |
| SMILES | COc1ccc(C(Nc2ccc(Cl)cc2)C(N)=O)cn1 |
| InChI | InChI=1S/C14H14ClN3O2/c1-20-12-7-2-9(8-17-12)13(14(16)19)18-11-5-3-10(15)4-6-11/h2-8,13,18H,1H3,(H2,16,19) |
| InChIKey | QOOMBCSZEDCMSS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |