C24H20BrNO — CID 11582463
(1S,2S)-2-[(4-bromonaphthalen-1-yl)amino]-1,2-diphenylethanol (PubChem CID 11582463) has the molecular formula C24H20BrNO and a molecular weight of 418.33 g/mol. Its IUPAC name is (1S,2S)-2-[(4-bromonaphthalen-1-yl)amino]-1,2-diphenylethanol.
| Compound Name | (1S,2S)-2-[(4-bromonaphthalen-1-yl)amino]-1,2-diphenylethanol |
|---|---|
| PubChem CID | 11582463 |
| Molecular Formula | C24H20BrNO |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | (1S,2S)-2-[(4-bromonaphthalen-1-yl)amino]-1,2-diphenylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@@H](Nc1ccc(Br)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H20BrNO/c25-21-15-16-22(20-14-8-7-13-19(20)21)26-23(17-9-3-1-4-10-17)24(27)18-11-5-2-6-12-18/h1-16,23-24,26-27H/t23-,24-/m0/s1 |
| InChIKey | PCBNEFSIFLRCQK-ZEQRLZLVSA-N |
| XLogP | 6.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |