C10H12FNO3 — CID 134882071
(1R,2S)-1-(2-fluorophenyl)-2-nitrobutan-1-ol (PubChem CID 134882071) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is (1R,2S)-1-(2-fluorophenyl)-2-nitrobutan-1-ol.
| Compound Name | (1R,2S)-1-(2-fluorophenyl)-2-nitrobutan-1-ol |
|---|---|
| PubChem CID | 134882071 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (1R,2S)-1-(2-fluorophenyl)-2-nitrobutan-1-ol |
| SMILES | CC[C@@H]([C@H](O)c1ccccc1F)[N+](=O)[O-] |
| InChI | InChI=1S/C10H12FNO3/c1-2-9(12(14)15)10(13)7-5-3-4-6-8(7)11/h3-6,9-10,13H,2H2,1H3/t9-,10+/m0/s1 |
| InChIKey | VNENQIVWWGIXDH-VHSXEESVSA-N |
| XLogP | 1.91 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|