C10H11Br2FO3S — CID 102550407
2,2-dibromo-2-ethylsulfonyl-1-(2-fluorophenyl)ethanol (PubChem CID 102550407) has the molecular formula C10H11Br2FO3S and a molecular weight of 390.07 g/mol. Its IUPAC name is 2,2-dibromo-2-ethylsulfonyl-1-(2-fluorophenyl)ethanol.
| Compound Name | 2,2-dibromo-2-ethylsulfonyl-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 102550407 |
| Molecular Formula | C10H11Br2FO3S |
| Molecular Weight | 390.07 g/mol |
| Exact Mass | 387.88 |
| IUPAC Name | 2,2-dibromo-2-ethylsulfonyl-1-(2-fluorophenyl)ethanol |
| SMILES | CCS(=O)(=O)C(Br)(Br)C(O)c1ccccc1F |
| InChI | InChI=1S/C10H11Br2FO3S/c1-2-17(15,16)10(11,12)9(14)7-5-3-4-6-8(7)13/h3-6,9,14H,2H2,1H3 |
| InChIKey | AKLQOPRUUQYUHW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.07 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|