C15H21FO5S — CID 157321425
tert-butyl 2-[3-(2-fluorophenyl)-3-hydroxypropyl]sulfonylacetate (PubChem CID 157321425) has the molecular formula C15H21FO5S and a molecular weight of 332.39 g/mol. Its IUPAC name is tert-butyl 2-[3-(2-fluorophenyl)-3-hydroxypropyl]sulfonylacetate.
| Compound Name | tert-butyl 2-[3-(2-fluorophenyl)-3-hydroxypropyl]sulfonylacetate |
|---|---|
| PubChem CID | 157321425 |
| Molecular Formula | C15H21FO5S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | tert-butyl 2-[3-(2-fluorophenyl)-3-hydroxypropyl]sulfonylacetate |
| SMILES | CC(C)(C)OC(=O)CS(=O)(=O)CCC(O)c1ccccc1F |
| InChI | InChI=1S/C15H21FO5S/c1-15(2,3)21-14(18)10-22(19,20)9-8-13(17)11-6-4-5-7-12(11)16/h4-7,13,17H,8-10H2,1-3H3 |
| InChIKey | BEFBPCWCTCLFND-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |