C17H19FO3S — CID 110905376
2-[(3,5-dimethylphenyl)methylsulfonyl]-1-(2-fluorophenyl)ethanol (PubChem CID 110905376) has the molecular formula C17H19FO3S and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methylsulfonyl]-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-[(3,5-dimethylphenyl)methylsulfonyl]-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 110905376 |
| Molecular Formula | C17H19FO3S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methylsulfonyl]-1-(2-fluorophenyl)ethanol |
| SMILES | Cc1cc(C)cc(CS(=O)(=O)CC(O)c2ccccc2F)c1 |
| InChI | InChI=1S/C17H19FO3S/c1-12-7-13(2)9-14(8-12)10-22(20,21)11-17(19)15-5-3-4-6-16(15)18/h3-9,17,19H,10-11H2,1-2H3 |
| InChIKey | IPZYQLXMNWGZBC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |