C16H17FO3S — CID 110905401
1-(2-fluorophenyl)-2-(1-phenylethylsulfonyl)ethanol (PubChem CID 110905401) has the molecular formula C16H17FO3S and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-(1-phenylethylsulfonyl)ethanol.
| Compound Name | 1-(2-fluorophenyl)-2-(1-phenylethylsulfonyl)ethanol |
|---|---|
| PubChem CID | 110905401 |
| Molecular Formula | C16H17FO3S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(2-fluorophenyl)-2-(1-phenylethylsulfonyl)ethanol |
| SMILES | CC(c1ccccc1)S(=O)(=O)CC(O)c1ccccc1F |
| InChI | InChI=1S/C16H17FO3S/c1-12(13-7-3-2-4-8-13)21(19,20)11-16(18)14-9-5-6-10-15(14)17/h2-10,12,16,18H,11H2,1H3 |
| InChIKey | ZGWJMQPFZOODKX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |