C16H16F2O3S — CID 47559569
1-(2,4-difluorophenyl)-2-[(3-methylphenyl)methylsulfonyl]ethanol (PubChem CID 47559569) has the molecular formula C16H16F2O3S and a molecular weight of 326.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-[(3-methylphenyl)methylsulfonyl]ethanol.
| Compound Name | 1-(2,4-difluorophenyl)-2-[(3-methylphenyl)methylsulfonyl]ethanol |
|---|---|
| PubChem CID | 47559569 |
| Molecular Formula | C16H16F2O3S |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-[(3-methylphenyl)methylsulfonyl]ethanol |
| SMILES | Cc1cccc(CS(=O)(=O)CC(O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H16F2O3S/c1-11-3-2-4-12(7-11)9-22(20,21)10-16(19)14-6-5-13(17)8-15(14)18/h2-8,16,19H,9-10H2,1H3 |
| InChIKey | QNEOPKZMZGSYSB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |